C28H21F3N4O3 — CID 135583232
3-hydroxy-4-[(E)-[(7-methoxy-4-methylquinolin-2-yl)hydrazinylidene]methyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one (PubChem CID 135583232) has the molecular formula C28H21F3N4O3 and a molecular weight of 518.50 g/mol. Its IUPAC name is 3-hydroxy-4-[(E)-[(7-methoxy-4-methylquinolin-2-yl)hydrazinylidene]methyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one.
| Compound Name | 3-hydroxy-4-[(E)-[(7-methoxy-4-methylquinolin-2-yl)hydrazinylidene]methyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 135583232 |
| Molecular Formula | C28H21F3N4O3 |
| Molecular Weight | 518.50 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 3-hydroxy-4-[(E)-[(7-methoxy-4-methylquinolin-2-yl)hydrazinylidene]methyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
| SMILES | COc1ccc2c(C)cc(N/N=C/c3c(O)n(-c4cccc(C(F)(F)F)c4)c(=O)c4ccccc34)nc2c1 |
| InChI | InChI=1S/C28H21F3N4O3/c1-16-12-25(33-24-14-19(38-2)10-11-20(16)24)34-32-15-23-21-8-3-4-9-22(21)26(36)35(27(23)37)18-7-5-6-17(13-18)28(29,30)31/h3-15,37H,1-2H3,(H,33,34)/b32-15+ |
| InChIKey | XBKZYUSXNHYFNV-VWJSQJICSA-N |
| XLogP | 6.03 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|