C21H16ClF3N2O4S — CID 135880255
2-[2-chloro-5-(trifluoromethyl)phenyl]-4-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-3-hydroxyisoquinolin-1-one (PubChem CID 135880255) has the molecular formula C21H16ClF3N2O4S and a molecular weight of 484.88 g/mol. Its IUPAC name is 2-[2-chloro-5-(trifluoromethyl)phenyl]-4-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-3-hydroxyisoquinolin-1-one.
| Compound Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]-4-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-3-hydroxyisoquinolin-1-one |
|---|---|
| PubChem CID | 135880255 |
| Molecular Formula | C21H16ClF3N2O4S |
| Molecular Weight | 484.88 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]-4-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-3-hydroxyisoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(/C=N/[C@H]2CCS(=O)(=O)C2)c(O)n1-c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C21H16ClF3N2O4S/c22-17-6-5-12(21(23,24)25)9-18(17)27-19(28)15-4-2-1-3-14(15)16(20(27)29)10-26-13-7-8-32(30,31)11-13/h1-6,9-10,13,29H,7-8,11H2/b26-10+/t13-/m0/s1 |
| InChIKey | RVJANBNAAGVUIA-GZYRGAMJSA-N |
| XLogP | 3.97 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|