C12H8F3N3 — CID 59053612
9-(trifluoromethyl)pyrido[1,2-a]benzimidazol-7-amine (PubChem CID 59053612) has the molecular formula C12H8F3N3 and a molecular weight of 251.21 g/mol. Its IUPAC name is 9-(trifluoromethyl)pyrido[1,2-a]benzimidazol-7-amine.
| Compound Name | 9-(trifluoromethyl)pyrido[1,2-a]benzimidazol-7-amine |
|---|---|
| PubChem CID | 59053612 |
| Molecular Formula | C12H8F3N3 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 9-(trifluoromethyl)pyrido[1,2-a]benzimidazol-7-amine |
| SMILES | Nc1cc(C(F)(F)F)c2c(c1)nc1ccccn12 |
| InChI | InChI=1S/C12H8F3N3/c13-12(14,15)8-5-7(16)6-9-11(8)18-4-2-1-3-10(18)17-9/h1-6H,16H2 |
| InChIKey | JCTLPYRBGGVREW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|