C13H14F3NO — CID 117120930
2-[1-ethyl-5-(trifluoromethyl)indol-3-yl]ethanol (PubChem CID 117120930) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-[1-ethyl-5-(trifluoromethyl)indol-3-yl]ethanol.
| Compound Name | 2-[1-ethyl-5-(trifluoromethyl)indol-3-yl]ethanol |
|---|---|
| PubChem CID | 117120930 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-[1-ethyl-5-(trifluoromethyl)indol-3-yl]ethanol |
| SMILES | CCn1cc(CCO)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C13H14F3NO/c1-2-17-8-9(5-6-18)11-7-10(13(14,15)16)3-4-12(11)17/h3-4,7-8,18H,2,5-6H2,1H3 |
| InChIKey | KSUDNJPPWGNYOP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |