C14H17F3N2 — CID 117120954
3-[1-ethyl-5-(trifluoromethyl)indol-3-yl]propan-1-amine (PubChem CID 117120954) has the molecular formula C14H17F3N2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 3-[1-ethyl-5-(trifluoromethyl)indol-3-yl]propan-1-amine.
| Compound Name | 3-[1-ethyl-5-(trifluoromethyl)indol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 117120954 |
| Molecular Formula | C14H17F3N2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 3-[1-ethyl-5-(trifluoromethyl)indol-3-yl]propan-1-amine |
| SMILES | CCn1cc(CCCN)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H17F3N2/c1-2-19-9-10(4-3-7-18)12-8-11(14(15,16)17)5-6-13(12)19/h5-6,8-9H,2-4,7,18H2,1H3 |
| InChIKey | AWMWNAYNADNVOH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |