C15H18F3NO — CID 117120932
1-[1-ethyl-5-(trifluoromethyl)indol-3-yl]-2-methylpropan-2-ol (PubChem CID 117120932) has the molecular formula C15H18F3NO and a molecular weight of 285.31 g/mol. Its IUPAC name is 1-[1-ethyl-5-(trifluoromethyl)indol-3-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[1-ethyl-5-(trifluoromethyl)indol-3-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 117120932 |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-[1-ethyl-5-(trifluoromethyl)indol-3-yl]-2-methylpropan-2-ol |
| SMILES | CCn1cc(CC(C)(C)O)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C15H18F3NO/c1-4-19-9-10(8-14(2,3)20)12-7-11(15(16,17)18)5-6-13(12)19/h5-7,9,20H,4,8H2,1-3H3 |
| InChIKey | FCCWJKDVIJSHRI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |