C26H27BrN4 — CID 123428403
2-(bromomethyl)-1-ethyl-6-methylindole-3-carbonitrile;1-ethyl-2,6-dimethylindole-3-carbonitrile (PubChem CID 123428403) has the molecular formula C26H27BrN4 and a molecular weight of 475.43 g/mol. Its IUPAC name is 2-(bromomethyl)-1-ethyl-6-methylindole-3-carbonitrile;1-ethyl-2,6-dimethylindole-3-carbonitrile.
| Compound Name | 2-(bromomethyl)-1-ethyl-6-methylindole-3-carbonitrile;1-ethyl-2,6-dimethylindole-3-carbonitrile |
|---|---|
| PubChem CID | 123428403 |
| Molecular Formula | C26H27BrN4 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 2-(bromomethyl)-1-ethyl-6-methylindole-3-carbonitrile;1-ethyl-2,6-dimethylindole-3-carbonitrile |
| SMILES | CCn1c(C)c(C#N)c2ccc(C)cc21.CCn1c(CBr)c(C#N)c2ccc(C)cc21 |
| InChI | InChI=1S/C13H13BrN2.C13H14N2/c1-3-16-12-6-9(2)4-5-10(12)11(8-15)13(16)7-14;1-4-15-10(3)12(8-14)11-6-5-9(2)7-13(11)15/h4-6H,3,7H2,1-2H3;5-7H,4H2,1-3H3 |
| InChIKey | KHKGXAYDVOWJIJ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|