C21H21N3O2 — CID 58039098
ethyl N-[3-(3-cyano-1-ethyl-6-methylindol-2-yl)phenyl]carbamate (PubChem CID 58039098) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is ethyl N-[3-(3-cyano-1-ethyl-6-methylindol-2-yl)phenyl]carbamate.
| Compound Name | ethyl N-[3-(3-cyano-1-ethyl-6-methylindol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 58039098 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | ethyl N-[3-(3-cyano-1-ethyl-6-methylindol-2-yl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(-c2c(C#N)c3ccc(C)cc3n2CC)c1 |
| InChI | InChI=1S/C21H21N3O2/c1-4-24-19-11-14(3)9-10-17(19)18(13-22)20(24)15-7-6-8-16(12-15)23-21(25)26-5-2/h6-12H,4-5H2,1-3H3,(H,23,25) |
| InChIKey | CNCADABLBVPBEN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |