C25H21N3O3 — CID 58694220
phenyl N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate (PubChem CID 58694220) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is phenyl N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate.
| Compound Name | phenyl N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 58694220 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | phenyl N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate |
| SMILES | CCn1c(-c2cccc(NC(=O)Oc3ccccc3)c2)c(C#N)c2ccc(OC)cc21 |
| InChI | InChI=1S/C25H21N3O3/c1-3-28-23-15-20(30-2)12-13-21(23)22(16-26)24(28)17-8-7-9-18(14-17)27-25(29)31-19-10-5-4-6-11-19/h4-15H,3H2,1-2H3,(H,27,29) |
| InChIKey | ZFIFXMSNBQUYIC-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |