C24H23N3O3 — CID 89024512
phenyl N-[3-(3-amino-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate (PubChem CID 89024512) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is phenyl N-[3-(3-amino-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate.
| Compound Name | phenyl N-[3-(3-amino-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 89024512 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | phenyl N-[3-(3-amino-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate |
| SMILES | CCn1c(-c2cccc(NC(=O)Oc3ccccc3)c2)c(N)c2ccc(OC)cc21 |
| InChI | InChI=1S/C24H23N3O3/c1-3-27-21-15-19(29-2)12-13-20(21)22(25)23(27)16-8-7-9-17(14-16)26-24(28)30-18-10-5-4-6-11-18/h4-15H,3,25H2,1-2H3,(H,26,28) |
| InChIKey | ZPXONIYDHGQWFC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |