C21H25N3O3 — CID 70844655
propyl N-[3-(3-amino-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate (PubChem CID 70844655) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is propyl N-[3-(3-amino-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate.
| Compound Name | propyl N-[3-(3-amino-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 70844655 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | propyl N-[3-(3-amino-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate |
| SMILES | CCCOC(=O)Nc1cccc(-c2c(N)c3ccc(OC)cc3n2CC)c1 |
| InChI | InChI=1S/C21H25N3O3/c1-4-11-27-21(25)23-15-8-6-7-14(12-15)20-19(22)17-10-9-16(26-3)13-18(17)24(20)5-2/h6-10,12-13H,4-5,11,22H2,1-3H3,(H,23,25) |
| InChIKey | KIIZIMDFEHYBOQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |