C23H29N3O3 — CID 70805366
ethyl N-[3-(3-amino-1-butyl-6-ethoxyindol-2-yl)phenyl]carbamate (PubChem CID 70805366) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is ethyl N-[3-(3-amino-1-butyl-6-ethoxyindol-2-yl)phenyl]carbamate.
| Compound Name | ethyl N-[3-(3-amino-1-butyl-6-ethoxyindol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 70805366 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | ethyl N-[3-(3-amino-1-butyl-6-ethoxyindol-2-yl)phenyl]carbamate |
| SMILES | CCCCn1c(-c2cccc(NC(=O)OCC)c2)c(N)c2ccc(OCC)cc21 |
| InChI | InChI=1S/C23H29N3O3/c1-4-7-13-26-20-15-18(28-5-2)11-12-19(20)21(24)22(26)16-9-8-10-17(14-16)25-23(27)29-6-3/h8-12,14-15H,4-7,13,24H2,1-3H3,(H,25,27) |
| InChIKey | VTRRPMPMOQBKRW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |