C22H26ClN3O3 — CID 89024374
2-chloroethyl N-[3-(3-amino-1-ethyl-6-propan-2-yloxyindol-2-yl)phenyl]carbamate (PubChem CID 89024374) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is 2-chloroethyl N-[3-(3-amino-1-ethyl-6-propan-2-yloxyindol-2-yl)phenyl]carbamate.
| Compound Name | 2-chloroethyl N-[3-(3-amino-1-ethyl-6-propan-2-yloxyindol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 89024374 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2-chloroethyl N-[3-(3-amino-1-ethyl-6-propan-2-yloxyindol-2-yl)phenyl]carbamate |
| SMILES | CCn1c(-c2cccc(NC(=O)OCCCl)c2)c(N)c2ccc(OC(C)C)cc21 |
| InChI | InChI=1S/C22H26ClN3O3/c1-4-26-19-13-17(29-14(2)3)8-9-18(19)20(24)21(26)15-6-5-7-16(12-15)25-22(27)28-11-10-23/h5-9,12-14H,4,10-11,24H2,1-3H3,(H,25,27) |
| InChIKey | UMOOMVHDYRKWRF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|