C22H23N3O3 — CID 58694159
propyl N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate (PubChem CID 58694159) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is propyl N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate.
| Compound Name | propyl N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 58694159 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | propyl N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate |
| SMILES | CCCOC(=O)Nc1cccc(-c2c(C#N)c3ccc(OC)cc3n2CC)c1 |
| InChI | InChI=1S/C22H23N3O3/c1-4-11-28-22(26)24-16-8-6-7-15(12-16)21-19(14-23)18-10-9-17(27-3)13-20(18)25(21)5-2/h6-10,12-13H,4-5,11H2,1-3H3,(H,24,26) |
| InChIKey | UMJMCGMYRYJNLB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |