C24H23N3O4 — CID 143184279
(2-methylideneoxolan-3-yl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate (PubChem CID 143184279) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is (2-methylideneoxolan-3-yl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate.
| Compound Name | (2-methylideneoxolan-3-yl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 143184279 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (2-methylideneoxolan-3-yl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate |
| SMILES | C=C1OCCC1OC(=O)Nc1cccc(-c2c(C#N)c3ccc(OC)cc3n2CC)c1 |
| InChI | InChI=1S/C24H23N3O4/c1-4-27-21-13-18(29-3)8-9-19(21)20(14-25)23(27)16-6-5-7-17(12-16)26-24(28)31-22-10-11-30-15(22)2/h5-9,12-13,22H,2,4,10-11H2,1,3H3,(H,26,28) |
| InChIKey | PYFSEQNFTNOAQL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |