C23H25N3O3 — CID 58694187
2-methylpropyl N-[4-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate (PubChem CID 58694187) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-methylpropyl N-[4-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate.
| Compound Name | 2-methylpropyl N-[4-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 58694187 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-methylpropyl N-[4-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate |
| SMILES | CCn1c(-c2ccc(NC(=O)OCC(C)C)cc2)c(C#N)c2ccc(OC)cc21 |
| InChI | InChI=1S/C23H25N3O3/c1-5-26-21-12-18(28-4)10-11-19(21)20(13-24)22(26)16-6-8-17(9-7-16)25-23(27)29-14-15(2)3/h6-12,15H,5,14H2,1-4H3,(H,25,27) |
| InChIKey | MGAPJTDWXQPRPX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |