C23H24FN3O4 — CID 59425203
2-fluoroethyl N-[4-[3-cyano-1-ethyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamate (PubChem CID 59425203) has the molecular formula C23H24FN3O4 and a molecular weight of 425.46 g/mol. Its IUPAC name is 2-fluoroethyl N-[4-[3-cyano-1-ethyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamate.
| Compound Name | 2-fluoroethyl N-[4-[3-cyano-1-ethyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 59425203 |
| Molecular Formula | C23H24FN3O4 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-fluoroethyl N-[4-[3-cyano-1-ethyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamate |
| SMILES | CCn1c(-c2ccc(NC(=O)OCCF)cc2)c(C#N)c2ccc(OCCOC)cc21 |
| InChI | InChI=1S/C23H24FN3O4/c1-3-27-21-14-18(30-13-12-29-2)8-9-19(21)20(15-25)22(27)16-4-6-17(7-5-16)26-23(28)31-11-10-24/h4-9,14H,3,10-13H2,1-2H3,(H,26,28) |
| InChIKey | YCHVVDXRPNFHMB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|