C28H34N4O3 — CID 58694260
ethyl N-[4-[3-cyano-1-ethyl-6-(3-piperidin-1-ylpropoxy)indol-2-yl]phenyl]carbamate (PubChem CID 58694260) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is ethyl N-[4-[3-cyano-1-ethyl-6-(3-piperidin-1-ylpropoxy)indol-2-yl]phenyl]carbamate.
| Compound Name | ethyl N-[4-[3-cyano-1-ethyl-6-(3-piperidin-1-ylpropoxy)indol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 58694260 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | ethyl N-[4-[3-cyano-1-ethyl-6-(3-piperidin-1-ylpropoxy)indol-2-yl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(-c2c(C#N)c3ccc(OCCCN4CCCCC4)cc3n2CC)cc1 |
| InChI | InChI=1S/C28H34N4O3/c1-3-32-26-19-23(35-18-8-17-31-15-6-5-7-16-31)13-14-24(26)25(20-29)27(32)21-9-11-22(12-10-21)30-28(33)34-4-2/h9-14,19H,3-8,15-18H2,1-2H3,(H,30,33) |
| InChIKey | ZVDWFSJNNUJRQW-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|