C30H42N4O3 — CID 143185087
N-[3-[3-cyano-1-ethyl-6-(3-pyrrolidin-1-ylpropoxy)indol-2-yl]phenyl]formamide;ethane;methoxyethane (PubChem CID 143185087) has the molecular formula C30H42N4O3 and a molecular weight of 506.69 g/mol. Its IUPAC name is N-[3-[3-cyano-1-ethyl-6-(3-pyrrolidin-1-ylpropoxy)indol-2-yl]phenyl]formamide;ethane;methoxyethane.
| Compound Name | N-[3-[3-cyano-1-ethyl-6-(3-pyrrolidin-1-ylpropoxy)indol-2-yl]phenyl]formamide;ethane;methoxyethane |
|---|---|
| PubChem CID | 143185087 |
| Molecular Formula | C30H42N4O3 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.33 |
| IUPAC Name | N-[3-[3-cyano-1-ethyl-6-(3-pyrrolidin-1-ylpropoxy)indol-2-yl]phenyl]formamide;ethane;methoxyethane |
| SMILES | CC.CCOC.CCn1c(-c2cccc(NC=O)c2)c(C#N)c2ccc(OCCCN3CCCC3)cc21 |
| InChI | InChI=1S/C25H28N4O2.C3H8O.C2H6/c1-2-29-24-16-21(31-14-6-13-28-11-3-4-12-28)9-10-22(24)23(17-26)25(29)19-7-5-8-20(15-19)27-18-30;1-3-4-2;1-2/h5,7-10,15-16,18H,2-4,6,11-14H2,1H3,(H,27,30);3H2,1-2H3;1-2H3 |
| InChIKey | UOHSRIMGZSHAKI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|