C20H21N3O2 — CID 59425879
2-(4-aminophenyl)-1-ethyl-6-(2-methoxyethoxy)indole-3-carbonitrile (PubChem CID 59425879) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-ethyl-6-(2-methoxyethoxy)indole-3-carbonitrile.
| Compound Name | 2-(4-aminophenyl)-1-ethyl-6-(2-methoxyethoxy)indole-3-carbonitrile |
|---|---|
| PubChem CID | 59425879 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-(4-aminophenyl)-1-ethyl-6-(2-methoxyethoxy)indole-3-carbonitrile |
| SMILES | CCn1c(-c2ccc(N)cc2)c(C#N)c2ccc(OCCOC)cc21 |
| InChI | InChI=1S/C20H21N3O2/c1-3-23-19-12-16(25-11-10-24-2)8-9-17(19)18(13-21)20(23)14-4-6-15(22)7-5-14/h4-9,12H,3,10-11,22H2,1-2H3 |
| InChIKey | IFQYINSDNOXWKC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|