C24H24FN3O3 — CID 58039115
propyl N-[4-[3-cyano-1-(cyclopropylmethyl)-6-(fluoromethoxy)indol-2-yl]phenyl]carbamate (PubChem CID 58039115) has the molecular formula C24H24FN3O3 and a molecular weight of 421.47 g/mol. Its IUPAC name is propyl N-[4-[3-cyano-1-(cyclopropylmethyl)-6-(fluoromethoxy)indol-2-yl]phenyl]carbamate.
| Compound Name | propyl N-[4-[3-cyano-1-(cyclopropylmethyl)-6-(fluoromethoxy)indol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 58039115 |
| Molecular Formula | C24H24FN3O3 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | propyl N-[4-[3-cyano-1-(cyclopropylmethyl)-6-(fluoromethoxy)indol-2-yl]phenyl]carbamate |
| SMILES | CCCOC(=O)Nc1ccc(-c2c(C#N)c3ccc(OCF)cc3n2CC2CC2)cc1 |
| InChI | InChI=1S/C24H24FN3O3/c1-2-11-30-24(29)27-18-7-5-17(6-8-18)23-21(13-26)20-10-9-19(31-15-25)12-22(20)28(23)14-16-3-4-16/h5-10,12,16H,2-4,11,14-15H2,1H3,(H,27,29) |
| InChIKey | CJHCOAAGMTWYES-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |