C28H25N3O4 — CID 88979329
benzyl N-[4-[3-cyano-1-(cyclopropylmethyl)-6-methylperoxyindol-2-yl]phenyl]carbamate (PubChem CID 88979329) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is benzyl N-[4-[3-cyano-1-(cyclopropylmethyl)-6-methylperoxyindol-2-yl]phenyl]carbamate.
| Compound Name | benzyl N-[4-[3-cyano-1-(cyclopropylmethyl)-6-methylperoxyindol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 88979329 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | benzyl N-[4-[3-cyano-1-(cyclopropylmethyl)-6-methylperoxyindol-2-yl]phenyl]carbamate |
| SMILES | COOc1ccc2c(C#N)c(-c3ccc(NC(=O)OCc4ccccc4)cc3)n(CC3CC3)c2c1 |
| InChI | InChI=1S/C28H25N3O4/c1-33-35-23-13-14-24-25(16-29)27(31(26(24)15-23)17-19-7-8-19)21-9-11-22(12-10-21)30-28(32)34-18-20-5-3-2-4-6-20/h2-6,9-15,19H,7-8,17-18H2,1H3,(H,30,32) |
| InChIKey | USENQQIVHVJZFI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|