C27H22F3N3O2 — CID 25051359
N-[4-[3-cyano-1-ethyl-6-(trifluoromethoxy)indol-2-yl]phenyl]-3-phenylpropanamide (PubChem CID 25051359) has the molecular formula C27H22F3N3O2 and a molecular weight of 477.49 g/mol. Its IUPAC name is N-[4-[3-cyano-1-ethyl-6-(trifluoromethoxy)indol-2-yl]phenyl]-3-phenylpropanamide.
| Compound Name | N-[4-[3-cyano-1-ethyl-6-(trifluoromethoxy)indol-2-yl]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 25051359 |
| Molecular Formula | C27H22F3N3O2 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[4-[3-cyano-1-ethyl-6-(trifluoromethoxy)indol-2-yl]phenyl]-3-phenylpropanamide |
| SMILES | CCn1c(-c2ccc(NC(=O)CCc3ccccc3)cc2)c(C#N)c2ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C27H22F3N3O2/c1-2-33-24-16-21(35-27(28,29)30)13-14-22(24)23(17-31)26(33)19-9-11-20(12-10-19)32-25(34)15-8-18-6-4-3-5-7-18/h3-7,9-14,16H,2,8,15H2,1H3,(H,32,34) |
| InChIKey | GZOKQLGMBAYDCR-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |