C19H16F3N3O3 — CID 143511546
1-ethyl-2-[4-(hydroperoxymethylamino)phenyl]-6-(trifluoromethoxy)indole-3-carbonitrile (PubChem CID 143511546) has the molecular formula C19H16F3N3O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is 1-ethyl-2-[4-(hydroperoxymethylamino)phenyl]-6-(trifluoromethoxy)indole-3-carbonitrile.
| Compound Name | 1-ethyl-2-[4-(hydroperoxymethylamino)phenyl]-6-(trifluoromethoxy)indole-3-carbonitrile |
|---|---|
| PubChem CID | 143511546 |
| Molecular Formula | C19H16F3N3O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 1-ethyl-2-[4-(hydroperoxymethylamino)phenyl]-6-(trifluoromethoxy)indole-3-carbonitrile |
| SMILES | CCn1c(-c2ccc(NCOO)cc2)c(C#N)c2ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C19H16F3N3O3/c1-2-25-17-9-14(28-19(20,21)22)7-8-15(17)16(10-23)18(25)12-3-5-13(6-4-12)24-11-27-26/h3-9,24,26H,2,11H2,1H3 |
| InChIKey | VKPXRRQGJHNPCM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|