C22H21F2N3O — CID 143184641
6-(difluoromethoxy)-1-ethyl-2-(4-pyrrolidin-1-ylphenyl)indole-3-carbonitrile (PubChem CID 143184641) has the molecular formula C22H21F2N3O and a molecular weight of 381.43 g/mol. Its IUPAC name is 6-(difluoromethoxy)-1-ethyl-2-(4-pyrrolidin-1-ylphenyl)indole-3-carbonitrile.
| Compound Name | 6-(difluoromethoxy)-1-ethyl-2-(4-pyrrolidin-1-ylphenyl)indole-3-carbonitrile |
|---|---|
| PubChem CID | 143184641 |
| Molecular Formula | C22H21F2N3O |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 6-(difluoromethoxy)-1-ethyl-2-(4-pyrrolidin-1-ylphenyl)indole-3-carbonitrile |
| SMILES | CCn1c(-c2ccc(N3CCCC3)cc2)c(C#N)c2ccc(OC(F)F)cc21 |
| InChI | InChI=1S/C22H21F2N3O/c1-2-27-20-13-17(28-22(23)24)9-10-18(20)19(14-25)21(27)15-5-7-16(8-6-15)26-11-3-4-12-26/h5-10,13,22H,2-4,11-12H2,1H3 |
| InChIKey | FQZXOELBVXKUME-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 41.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|