C23H21F2N3O3 — CID 58694483
ethyl N-[4-[3-cyano-1-(cyclopropylmethyl)-6-(difluoromethoxy)indol-2-yl]phenyl]carbamate (PubChem CID 58694483) has the molecular formula C23H21F2N3O3 and a molecular weight of 425.44 g/mol. Its IUPAC name is ethyl N-[4-[3-cyano-1-(cyclopropylmethyl)-6-(difluoromethoxy)indol-2-yl]phenyl]carbamate.
| Compound Name | ethyl N-[4-[3-cyano-1-(cyclopropylmethyl)-6-(difluoromethoxy)indol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 58694483 |
| Molecular Formula | C23H21F2N3O3 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | ethyl N-[4-[3-cyano-1-(cyclopropylmethyl)-6-(difluoromethoxy)indol-2-yl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(-c2c(C#N)c3ccc(OC(F)F)cc3n2CC2CC2)cc1 |
| InChI | InChI=1S/C23H21F2N3O3/c1-2-30-23(29)27-16-7-5-15(6-8-16)21-19(12-26)18-10-9-17(31-22(24)25)11-20(18)28(21)13-14-3-4-14/h5-11,14,22H,2-4,13H2,1H3,(H,27,29) |
| InChIKey | VQLNYAJASGPEIF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |