C26H33FN4O4 — CID 88566470
2-fluoroethyl N-[4-[3-amino-1-ethyl-6-(3-morpholin-4-ylpropoxy)indol-2-yl]phenyl]carbamate (PubChem CID 88566470) has the molecular formula C26H33FN4O4 and a molecular weight of 484.57 g/mol. Its IUPAC name is 2-fluoroethyl N-[4-[3-amino-1-ethyl-6-(3-morpholin-4-ylpropoxy)indol-2-yl]phenyl]carbamate.
| Compound Name | 2-fluoroethyl N-[4-[3-amino-1-ethyl-6-(3-morpholin-4-ylpropoxy)indol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 88566470 |
| Molecular Formula | C26H33FN4O4 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 2-fluoroethyl N-[4-[3-amino-1-ethyl-6-(3-morpholin-4-ylpropoxy)indol-2-yl]phenyl]carbamate |
| SMILES | CCn1c(-c2ccc(NC(=O)OCCF)cc2)c(N)c2ccc(OCCCN3CCOCC3)cc21 |
| InChI | InChI=1S/C26H33FN4O4/c1-2-31-23-18-21(34-14-3-11-30-12-16-33-17-13-30)8-9-22(23)24(28)25(31)19-4-6-20(7-5-19)29-26(32)35-15-10-27/h4-9,18H,2-3,10-17,28H2,1H3,(H,29,32) |
| InChIKey | RXIUBITUGYVXAX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|