C27H39N5O — CID 71176666
2-(4-hydrazinylphenyl)-1-pentyl-6-(4-pyrrolidin-1-ylbutoxy)indol-3-amine (PubChem CID 71176666) has the molecular formula C27H39N5O and a molecular weight of 449.64 g/mol. Its IUPAC name is 2-(4-hydrazinylphenyl)-1-pentyl-6-(4-pyrrolidin-1-ylbutoxy)indol-3-amine.
| Compound Name | 2-(4-hydrazinylphenyl)-1-pentyl-6-(4-pyrrolidin-1-ylbutoxy)indol-3-amine |
|---|---|
| PubChem CID | 71176666 |
| Molecular Formula | C27H39N5O |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.32 |
| IUPAC Name | 2-(4-hydrazinylphenyl)-1-pentyl-6-(4-pyrrolidin-1-ylbutoxy)indol-3-amine |
| SMILES | CCCCCn1c(-c2ccc(NN)cc2)c(N)c2ccc(OCCCCN3CCCC3)cc21 |
| InChI | InChI=1S/C27H39N5O/c1-2-3-4-18-32-25-20-23(33-19-8-7-17-31-15-5-6-16-31)13-14-24(25)26(28)27(32)21-9-11-22(30-29)12-10-21/h9-14,20,30H,2-8,15-19,28-29H2,1H3 |
| InChIKey | XJWNKXZOWYUNIF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|