C22H25F2N3O4 — CID 70844442
2-methoxyethyl N-[4-[3-amino-6-(difluoromethoxy)-1-propylindol-2-yl]phenyl]carbamate (PubChem CID 70844442) has the molecular formula C22H25F2N3O4 and a molecular weight of 433.46 g/mol. Its IUPAC name is 2-methoxyethyl N-[4-[3-amino-6-(difluoromethoxy)-1-propylindol-2-yl]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[4-[3-amino-6-(difluoromethoxy)-1-propylindol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 70844442 |
| Molecular Formula | C22H25F2N3O4 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-methoxyethyl N-[4-[3-amino-6-(difluoromethoxy)-1-propylindol-2-yl]phenyl]carbamate |
| SMILES | CCCn1c(-c2ccc(NC(=O)OCCOC)cc2)c(N)c2ccc(OC(F)F)cc21 |
| InChI | InChI=1S/C22H25F2N3O4/c1-3-10-27-18-13-16(31-21(23)24)8-9-17(18)19(25)20(27)14-4-6-15(7-5-14)26-22(28)30-12-11-29-2/h4-9,13,21H,3,10-12,25H2,1-2H3,(H,26,28) |
| InChIKey | UQECCYJKCUDVDX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|