C24H31N3O4 — CID 70844155
2-methylpropyl N-[4-[3-amino-1-ethyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamate (PubChem CID 70844155) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-methylpropyl N-[4-[3-amino-1-ethyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamate.
| Compound Name | 2-methylpropyl N-[4-[3-amino-1-ethyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 70844155 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 2-methylpropyl N-[4-[3-amino-1-ethyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamate |
| SMILES | CCn1c(-c2ccc(NC(=O)OCC(C)C)cc2)c(N)c2ccc(OCCOC)cc21 |
| InChI | InChI=1S/C24H31N3O4/c1-5-27-21-14-19(30-13-12-29-4)10-11-20(21)22(25)23(27)17-6-8-18(9-7-17)26-24(28)31-15-16(2)3/h6-11,14,16H,5,12-13,15,25H2,1-4H3,(H,26,28) |
| InChIKey | JWQPFQNPWIWXKI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|