C16H23N3O3 — CID 70844069
2-methylpropyl N-(3-amino-1-ethyl-6-methoxyindol-2-yl)carbamate (PubChem CID 70844069) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-methylpropyl N-(3-amino-1-ethyl-6-methoxyindol-2-yl)carbamate.
| Compound Name | 2-methylpropyl N-(3-amino-1-ethyl-6-methoxyindol-2-yl)carbamate |
|---|---|
| PubChem CID | 70844069 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2-methylpropyl N-(3-amino-1-ethyl-6-methoxyindol-2-yl)carbamate |
| SMILES | CCn1c(NC(=O)OCC(C)C)c(N)c2ccc(OC)cc21 |
| InChI | InChI=1S/C16H23N3O3/c1-5-19-13-8-11(21-4)6-7-12(13)14(17)15(19)18-16(20)22-9-10(2)3/h6-8,10H,5,9,17H2,1-4H3,(H,18,20) |
| InChIKey | MLCFOPJHBPHFDT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |