C24H25N3O3 — CID 58694204
ethyl N-[3-(3-cyano-1-cyclopentyl-6-methoxyindol-2-yl)phenyl]carbamate (PubChem CID 58694204) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is ethyl N-[3-(3-cyano-1-cyclopentyl-6-methoxyindol-2-yl)phenyl]carbamate.
| Compound Name | ethyl N-[3-(3-cyano-1-cyclopentyl-6-methoxyindol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 58694204 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | ethyl N-[3-(3-cyano-1-cyclopentyl-6-methoxyindol-2-yl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(-c2c(C#N)c3ccc(OC)cc3n2C2CCCC2)c1 |
| InChI | InChI=1S/C24H25N3O3/c1-3-30-24(28)26-17-8-6-7-16(13-17)23-21(15-25)20-12-11-19(29-2)14-22(20)27(23)18-9-4-5-10-18/h6-8,11-14,18H,3-5,9-10H2,1-2H3,(H,26,28) |
| InChIKey | MPYHPNTYDDYLPK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |