C21H24ClN3O3 — CID 89024430
3-chloropropyl N-[3-(3-amino-1-ethyl-5-methoxyindol-2-yl)phenyl]carbamate (PubChem CID 89024430) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is 3-chloropropyl N-[3-(3-amino-1-ethyl-5-methoxyindol-2-yl)phenyl]carbamate.
| Compound Name | 3-chloropropyl N-[3-(3-amino-1-ethyl-5-methoxyindol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 89024430 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 3-chloropropyl N-[3-(3-amino-1-ethyl-5-methoxyindol-2-yl)phenyl]carbamate |
| SMILES | CCn1c(-c2cccc(NC(=O)OCCCCl)c2)c(N)c2cc(OC)ccc21 |
| InChI | InChI=1S/C21H24ClN3O3/c1-3-25-18-9-8-16(27-2)13-17(18)19(23)20(25)14-6-4-7-15(12-14)24-21(26)28-11-5-10-22/h4,6-9,12-13H,3,5,10-11,23H2,1-2H3,(H,24,26) |
| InChIKey | WPFLIVDEAWOLLP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|