C13H14N2 — CID 22689233
1,2-diethylindole-3-carbonitrile (PubChem CID 22689233) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 1,2-diethylindole-3-carbonitrile.
| Compound Name | 1,2-diethylindole-3-carbonitrile |
|---|---|
| PubChem CID | 22689233 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1,2-diethylindole-3-carbonitrile |
| SMILES | CCc1c(C#N)c2ccccc2n1CC |
| InChI | InChI=1S/C13H14N2/c1-3-12-11(9-14)10-7-5-6-8-13(10)15(12)4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | ZSEZSFSBCUUQDX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |