C16H6I2N2 — CID 132838305
2,6-diiodoanthracene-9,10-dicarbonitrile (PubChem CID 132838305) has the molecular formula C16H6I2N2 and a molecular weight of 480.05 g/mol. Its IUPAC name is 2,6-diiodoanthracene-9,10-dicarbonitrile.
| Compound Name | 2,6-diiodoanthracene-9,10-dicarbonitrile |
|---|---|
| PubChem CID | 132838305 |
| Molecular Formula | C16H6I2N2 |
| Molecular Weight | 480.05 g/mol |
| Exact Mass | 479.86 |
| IUPAC Name | 2,6-diiodoanthracene-9,10-dicarbonitrile |
| SMILES | N#Cc1c2ccc(I)cc2c(C#N)c2ccc(I)cc12 |
| InChI | InChI=1S/C16H6I2N2/c17-9-1-3-11-13(5-9)16(8-20)12-4-2-10(18)6-14(12)15(11)7-19/h1-6H |
| InChIKey | RNVVOPMHPZOROT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.05 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|