About 2-fluoro-4,6-diiodobenzonitrile
2-fluoro-4,6-diiodobenzonitrile (PubChem CID 118997099) has the molecular formula C7H2FI2N
and a molecular weight of 372.91 g/mol. Its IUPAC name is 2-fluoro-4,6-diiodobenzonitrile.
Molecular Properties
| Compound Name | 2-fluoro-4,6-diiodobenzonitrile |
| PubChem CID | 118997099 |
| Molecular Formula | C7H2FI2N |
| Molecular Weight | 372.91 g/mol |
| Exact Mass | 372.83 |
| IUPAC Name | 2-fluoro-4,6-diiodobenzonitrile |
| SMILES | N#Cc1c(F)cc(I)cc1I |
| InChI | InChI=1S/C7H2FI2N/c8-6-1-4(9)2-7(10)5(6)3-11/h1-2H |
| InChIKey | CFPYYAMIUMTFMI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.91 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4,6-diiodobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4,6-diiodobenzonitrile?
The IUPAC name of 2-fluoro-4,6-diiodobenzonitrile (CID 118997099) is 2-fluoro-4,6-diiodobenzonitrile.
What is the SMILES notation for 2-fluoro-4,6-diiodobenzonitrile?
The canonical SMILES for 2-fluoro-4,6-diiodobenzonitrile is N#Cc1c(F)cc(I)cc1I.
What is the InChIKey of 2-fluoro-4,6-diiodobenzonitrile?
The InChIKey is CFPYYAMIUMTFMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2FI2N/c8-6-1-4(9)2-7(10)5(6)3-11/h1-2H.
What are the key properties of 2-fluoro-4,6-diiodobenzonitrile?
2-fluoro-4,6-diiodobenzonitrile has a molecular weight of 372.91 g/mol, XLogP of 2.91, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4,6-diiodobenzonitrile is sourced from PubChem (CID 118997099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).