C18H14Cl2 — CID 100958496
4,6-dichloro-2,3-dimethyl-1-(2,3,4,5,6-pentadeuteriophenyl)naphthalene (PubChem CID 100958496) has the molecular formula C18H14Cl2 and a molecular weight of 306.25 g/mol. Its IUPAC name is 4,6-dichloro-2,3-dimethyl-1-(2,3,4,5,6-pentadeuteriophenyl)naphthalene.
| Compound Name | 4,6-dichloro-2,3-dimethyl-1-(2,3,4,5,6-pentadeuteriophenyl)naphthalene |
|---|---|
| PubChem CID | 100958496 |
| Molecular Formula | C18H14Cl2 |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4,6-dichloro-2,3-dimethyl-1-(2,3,4,5,6-pentadeuteriophenyl)naphthalene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c(C)c(C)c(Cl)c3cc(Cl)ccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C18H14Cl2/c1-11-12(2)18(20)16-10-14(19)8-9-15(16)17(11)13-6-4-3-5-7-13/h3-10H,1-2H3/i3D,4D,5D,6D,7D |
| InChIKey | GULSOTFOQXHNFN-DKFMXDSJSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |