C15H17N — CID 118944078
2-(2,3,4,5,6-pentadeuteriophenyl)-6-propan-2-ylaniline (PubChem CID 118944078) has the molecular formula C15H17N and a molecular weight of 216.34 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentadeuteriophenyl)-6-propan-2-ylaniline.
| Compound Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-6-propan-2-ylaniline |
|---|---|
| PubChem CID | 118944078 |
| Molecular Formula | C15H17N |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-6-propan-2-ylaniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(C(C)C)c2N)c([2H])c1[2H] |
| InChI | InChI=1S/C15H17N/c1-11(2)13-9-6-10-14(15(13)16)12-7-4-3-5-8-12/h3-11H,16H2,1-2H3/i3D,4D,5D,7D,8D |
| InChIKey | RXZQLKDARHYURB-LOOCXSPQSA-N |
| XLogP | 4.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|