C15H19N3O3 — CID 123403323
4,5-diamino-6-(2-amino-3-propan-2-ylphenyl)benzene-1,2,3-triol (PubChem CID 123403323) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 4,5-diamino-6-(2-amino-3-propan-2-ylphenyl)benzene-1,2,3-triol.
| Compound Name | 4,5-diamino-6-(2-amino-3-propan-2-ylphenyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 123403323 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4,5-diamino-6-(2-amino-3-propan-2-ylphenyl)benzene-1,2,3-triol |
| SMILES | CC(C)c1cccc(-c2c(N)c(N)c(O)c(O)c2O)c1N |
| InChI | InChI=1S/C15H19N3O3/c1-6(2)7-4-3-5-8(10(7)16)9-11(17)12(18)14(20)15(21)13(9)19/h3-6,19-21H,16-18H2,1-2H3 |
| InChIKey | CVIWROPWNZJXAH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|