C14H10F6N2O4 — CID 151767200
4-amino-5-[3-amino-2-hydroxy-6-(trifluoromethyl)phenyl]-6-(trifluoromethyl)benzene-1,2,3-triol (PubChem CID 151767200) has the molecular formula C14H10F6N2O4 and a molecular weight of 384.23 g/mol. Its IUPAC name is 4-amino-5-[3-amino-2-hydroxy-6-(trifluoromethyl)phenyl]-6-(trifluoromethyl)benzene-1,2,3-triol.
| Compound Name | 4-amino-5-[3-amino-2-hydroxy-6-(trifluoromethyl)phenyl]-6-(trifluoromethyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 151767200 |
| Molecular Formula | C14H10F6N2O4 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 4-amino-5-[3-amino-2-hydroxy-6-(trifluoromethyl)phenyl]-6-(trifluoromethyl)benzene-1,2,3-triol |
| SMILES | Nc1ccc(C(F)(F)F)c(-c2c(N)c(O)c(O)c(O)c2C(F)(F)F)c1O |
| InChI | InChI=1S/C14H10F6N2O4/c15-13(16,17)3-1-2-4(21)9(23)5(3)6-7(14(18,19)20)10(24)12(26)11(25)8(6)22/h1-2,23-26H,21-22H2 |
| InChIKey | RRVFYIVFFOLFEZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|