C10H9NO4 — CID 123540994
8-aminonaphthalene-1,2,3,6-tetrol (PubChem CID 123540994) has the molecular formula C10H9NO4 and a molecular weight of 207.19 g/mol. Its IUPAC name is 8-aminonaphthalene-1,2,3,6-tetrol.
| Compound Name | 8-aminonaphthalene-1,2,3,6-tetrol |
|---|---|
| PubChem CID | 123540994 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 8-aminonaphthalene-1,2,3,6-tetrol |
| SMILES | Nc1cc(O)cc2cc(O)c(O)c(O)c12 |
| InChI | InChI=1S/C10H9NO4/c11-6-3-5(12)1-4-2-7(13)9(14)10(15)8(4)6/h1-3,12-15H,11H2 |
| InChIKey | UYZHPQLEBZHPSP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|