C10H9NO12S3 — CID 54125276
(4-amino-5,7-disulfooxynaphthalen-2-yl) hydrogen sulfate (PubChem CID 54125276) has the molecular formula C10H9NO12S3 and a molecular weight of 431.38 g/mol. Its IUPAC name is (4-amino-5,7-disulfooxynaphthalen-2-yl) hydrogen sulfate.
| Compound Name | (4-amino-5,7-disulfooxynaphthalen-2-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 54125276 |
| Molecular Formula | C10H9NO12S3 |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 430.93 |
| IUPAC Name | (4-amino-5,7-disulfooxynaphthalen-2-yl) hydrogen sulfate |
| SMILES | Nc1cc(OS(=O)(=O)O)cc2cc(OS(=O)(=O)O)cc(OS(=O)(=O)O)c12 |
| InChI | InChI=1S/C10H9NO12S3/c11-8-3-6(21-24(12,13)14)1-5-2-7(22-25(15,16)17)4-9(10(5)8)23-26(18,19)20/h1-4H,11H2,(H,12,13,14)(H,15,16,17)(H,18,19,20) |
| InChIKey | NQNARPFUCMYDNS-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 216.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|