C36H44N2 — CID 168780658
2-N-[4-tert-butyl-2-(3,5-ditert-butylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene-1,2-diamine (PubChem CID 168780658) has the molecular formula C36H44N2 and a molecular weight of 509.79 g/mol. Its IUPAC name is 2-N-[4-tert-butyl-2-(3,5-ditert-butylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene-1,2-diamine.
| Compound Name | 2-N-[4-tert-butyl-2-(3,5-ditert-butylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 168780658 |
| Molecular Formula | C36H44N2 |
| Molecular Weight | 509.79 g/mol |
| Exact Mass | 509.38 |
| IUPAC Name | 2-N-[4-tert-butyl-2-(3,5-ditert-butylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene-1,2-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(C(C)(C)C)cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c2Nc2ccccc2N)c([2H])c1[2H] |
| InChI | InChI=1S/C36H44N2/c1-34(2,3)26-19-25(20-27(21-26)35(4,5)6)30-23-28(36(7,8)9)22-29(24-15-11-10-12-16-24)33(30)38-32-18-14-13-17-31(32)37/h10-23,38H,37H2,1-9H3/i10D,11D,12D,15D,16D |
| InChIKey | BISWPFFPLBBVOU-DLVRKUMZSA-N |
| XLogP | 10.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.79 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|