C34H46IN — CID 176782776
2,4-ditert-butyl-6-(3,5-ditert-butylphenyl)-N-(2-iodophenyl)aniline (PubChem CID 176782776) has the molecular formula C34H46IN and a molecular weight of 595.65 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(3,5-ditert-butylphenyl)-N-(2-iodophenyl)aniline.
| Compound Name | 2,4-ditert-butyl-6-(3,5-ditert-butylphenyl)-N-(2-iodophenyl)aniline |
|---|---|
| PubChem CID | 176782776 |
| Molecular Formula | C34H46IN |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | 2,4-ditert-butyl-6-(3,5-ditert-butylphenyl)-N-(2-iodophenyl)aniline |
| SMILES | CC(C)(C)c1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2Nc2ccccc2I)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H46IN/c1-31(2,3)23-17-22(18-24(19-23)32(4,5)6)26-20-25(33(7,8)9)21-27(34(10,11)12)30(26)36-29-16-14-13-15-28(29)35/h13-21,36H,1-12H3 |
| InChIKey | MOYRYZVDGBTYHL-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|