C60H64N2 — CID 175098676
1-[3,5-bis(3,5-ditert-butylphenyl)phenyl]-2,6-diphenylanthracene-9,10-diamine (PubChem CID 175098676) has the molecular formula C60H64N2 and a molecular weight of 813.19 g/mol. Its IUPAC name is 1-[3,5-bis(3,5-ditert-butylphenyl)phenyl]-2,6-diphenylanthracene-9,10-diamine.
| Compound Name | 1-[3,5-bis(3,5-ditert-butylphenyl)phenyl]-2,6-diphenylanthracene-9,10-diamine |
|---|---|
| PubChem CID | 175098676 |
| Molecular Formula | C60H64N2 |
| Molecular Weight | 813.19 g/mol |
| Exact Mass | 812.51 |
| IUPAC Name | 1-[3,5-bis(3,5-ditert-butylphenyl)phenyl]-2,6-diphenylanthracene-9,10-diamine |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cc(-c3c(-c4ccccc4)ccc4c(N)c5cc(-c6ccccc6)ccc5c(N)c34)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C60H64N2/c1-57(2,3)45-30-42(31-46(35-45)58(4,5)6)40-27-41(43-32-47(59(7,8)9)36-48(33-43)60(10,11)12)29-44(28-40)53-49(38-21-17-14-18-22-38)25-26-51-54(53)56(62)50-24-23-39(34-52(50)55(51)61)37-19-15-13-16-20-37/h13-36H,61-62H2,1-12H3 |
| InChIKey | WZYRIFWLSFMUSL-UHFFFAOYSA-N |
| XLogP | 16.68 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.19 |
| LogP ≤ 5 | 16.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|