C57H53N2OPt- — CID 164742424
2,4-ditert-butyl-6-[4-phenyl-6-[3-[4-(2-phenylpropan-2-yl)phenyl]-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-2-pyridinyl]phenol;platinum (PubChem CID 164742424) has the molecular formula C57H53N2OPt- and a molecular weight of 977.14 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-phenyl-6-[3-[4-(2-phenylpropan-2-yl)phenyl]-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[4-phenyl-6-[3-[4-(2-phenylpropan-2-yl)phenyl]-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 164742424 |
| Molecular Formula | C57H53N2OPt- |
| Molecular Weight | 977.14 g/mol |
| Exact Mass | 976.38 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-phenyl-6-[3-[4-(2-phenylpropan-2-yl)phenyl]-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccccc3)cc(-c3[c-]c(-c4cc(-c5ccccc5)ccn4)cc(-c4ccc(C(C)(C)c5ccccc5)cc4)c3)n2)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C57H53N2O.Pt/c1-55(2,3)48-36-49(54(60)50(37-48)56(4,5)6)53-35-43(39-20-14-10-15-21-39)34-52(59-53)45-31-42(40-24-26-47(27-25-40)57(7,8)46-22-16-11-17-23-46)30-44(32-45)51-33-41(28-29-58-51)38-18-12-9-13-19-38;/h9-31,33-37,60H,1-8H3;/q-1; |
| InChIKey | SQATUSQKIJNCBR-UHFFFAOYSA-N |
| XLogP | 14.90 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.14 |
| LogP ≤ 5 | 14.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|