C49H33N4OPt- — CID 177093762
2-[1-methyl-4-[3-[4-[9-(3-phenylphenyl)carbazol-1-yl]-2-pyridinyl]benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 177093762) has the molecular formula C49H33N4OPt- and a molecular weight of 888.91 g/mol. Its IUPAC name is 2-[1-methyl-4-[3-[4-[9-(3-phenylphenyl)carbazol-1-yl]-2-pyridinyl]benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[1-methyl-4-[3-[4-[9-(3-phenylphenyl)carbazol-1-yl]-2-pyridinyl]benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 177093762 |
| Molecular Formula | C49H33N4OPt- |
| Molecular Weight | 888.91 g/mol |
| Exact Mass | 888.23 |
| IUPAC Name | 2-[1-methyl-4-[3-[4-[9-(3-phenylphenyl)carbazol-1-yl]-2-pyridinyl]benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | Cn1c(-c2ccccc2O)nc2c(-c3[c-]c(-c4cc(-c5cccc6c7ccccc7n(-c7cccc(-c8ccccc8)c7)c56)ccn4)ccc3)cccc21.[Pt] |
| InChI | InChI=1S/C49H33N4O.Pt/c1-52-45-25-12-21-38(47(45)51-49(52)42-20-6-8-26-46(42)54)34-16-9-17-36(29-34)43-31-35(27-28-50-43)39-22-11-23-41-40-19-5-7-24-44(40)53(48(39)41)37-18-10-15-33(30-37)32-13-3-2-4-14-32;/h2-28,30-31,54H,1H3;/q-1; |
| InChIKey | ZUEYVISQZBPNGY-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.91 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|