C30H31N2NiO- — CID 153499233
2-[3,5-ditert-butyl-6-(3-pyridin-2-ylbenzene-2-id-1-yl)-2-pyridinyl]phenol;nickel (PubChem CID 153499233) has the molecular formula C30H31N2NiO- and a molecular weight of 494.28 g/mol. Its IUPAC name is 2-[3,5-ditert-butyl-6-(3-pyridin-2-ylbenzene-2-id-1-yl)-2-pyridinyl]phenol;nickel.
| Compound Name | 2-[3,5-ditert-butyl-6-(3-pyridin-2-ylbenzene-2-id-1-yl)-2-pyridinyl]phenol;nickel |
|---|---|
| PubChem CID | 153499233 |
| Molecular Formula | C30H31N2NiO- |
| Molecular Weight | 494.28 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 2-[3,5-ditert-butyl-6-(3-pyridin-2-ylbenzene-2-id-1-yl)-2-pyridinyl]phenol;nickel |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(-c2ccccc2O)nc1-c1[c-]c(-c2ccccn2)ccc1.[Ni] |
| InChI | InChI=1S/C30H31N2O.Ni/c1-29(2,3)23-19-24(30(4,5)6)28(22-14-7-8-16-26(22)33)32-27(23)21-13-11-12-20(18-21)25-15-9-10-17-31-25;/h7-17,19,33H,1-6H3;/q-1; |
| InChIKey | XVBDPTAKNIJLMV-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.28 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|