C41H38N3O2Pt- — CID 153280372
2-[4-(3,5-ditert-butylphenyl)-6-(3-phenyl-5-pyridin-2-yloxybenzene-6-id-1-yl)pyrimidin-2-yl]phenol;platinum (PubChem CID 153280372) has the molecular formula C41H38N3O2Pt- and a molecular weight of 799.85 g/mol. Its IUPAC name is 2-[4-(3,5-ditert-butylphenyl)-6-(3-phenyl-5-pyridin-2-yloxybenzene-6-id-1-yl)pyrimidin-2-yl]phenol;platinum.
| Compound Name | 2-[4-(3,5-ditert-butylphenyl)-6-(3-phenyl-5-pyridin-2-yloxybenzene-6-id-1-yl)pyrimidin-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153280372 |
| Molecular Formula | C41H38N3O2Pt- |
| Molecular Weight | 799.85 g/mol |
| Exact Mass | 799.26 |
| IUPAC Name | 2-[4-(3,5-ditert-butylphenyl)-6-(3-phenyl-5-pyridin-2-yloxybenzene-6-id-1-yl)pyrimidin-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3[c-]c(Oc4ccccn4)cc(-c4ccccc4)c3)nc(-c3ccccc3O)n2)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C41H38N3O2.Pt/c1-40(2,3)31-21-30(22-32(25-31)41(4,5)6)36-26-35(43-39(44-36)34-16-10-11-17-37(34)45)29-20-28(27-14-8-7-9-15-27)23-33(24-29)46-38-18-12-13-19-42-38;/h7-23,25-26,45H,1-6H3;/q-1; |
| InChIKey | PXWFEJQYFIUOFO-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.85 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|