C45H37N2O2Pt- — CID 164743217
2-[6-[3-[[4-(4-benzylphenyl)-2-pyridinyl]oxy]-5-tert-butylbenzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum (PubChem CID 164743217) has the molecular formula C45H37N2O2Pt- and a molecular weight of 832.88 g/mol. Its IUPAC name is 2-[6-[3-[[4-(4-benzylphenyl)-2-pyridinyl]oxy]-5-tert-butylbenzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[6-[3-[[4-(4-benzylphenyl)-2-pyridinyl]oxy]-5-tert-butylbenzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 164743217 |
| Molecular Formula | C45H37N2O2Pt- |
| Molecular Weight | 832.88 g/mol |
| Exact Mass | 832.25 |
| IUPAC Name | 2-[6-[3-[[4-(4-benzylphenyl)-2-pyridinyl]oxy]-5-tert-butylbenzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(Oc2cc(-c3ccc(Cc4ccccc4)cc3)ccn2)[c-]c(-c2cc(-c3ccccc3)cc(-c3ccccc3O)n2)c1.[Pt] |
| InChI | InChI=1S/C45H37N2O2.Pt/c1-45(2,3)38-25-37(41-27-36(33-14-8-5-9-15-33)28-42(47-41)40-16-10-11-17-43(40)48)26-39(30-38)49-44-29-35(22-23-46-44)34-20-18-32(19-21-34)24-31-12-6-4-7-13-31;/h4-23,25,27-30,48H,24H2,1-3H3;/q-1; |
| InChIKey | KHPYVHXIARVVEA-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.88 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|